1. chem960
  2. 1941-17-9
Methanone, nitro(2-phenyldiazenyl)-, 2-[4-(1-methylethoxy)phenyl]hydrazone | 1941-17-9

Nome do produto:Methanone, nitro(2-phenyldiazenyl)-, 2-[4-(1-methylethoxy)phenyl]hydrazone

N.o CAS:1941-17-9
Nomes e Identificadores
  • Methanone, nitro(2-phenyldiazenyl)-, 2-[4-(1-methylethoxy)phenyl]hydrazone
  • Inchi:1S/C16H17N5O3/c1-12(2)24-15-10-8-14(9-11-15)18-20-16(21(22)23)19-17-13-6-4-3-5-7-13/h3-12,18H,1-2H3
  • SMILES:C(=NNC1=CC=C(OC(C)C)C=C1)([N+]([O-])=O)N=NC1=CC=CC=C1
©2008-2024 chem960.com Todos os direitos reservados